About N-[3,5-bis(3-propylsulfanylpropanoylamino)-1-adamantyl]-3-propylsulfanylpropanamide
N-[3,5-bis(3-propylsulfanylpropanoylamino)-1-adamantyl]-3-propylsulfanylpropanamide (PubChem CID 176584947) has the molecular formula C28H49N3O3S3
and a molecular weight of 571.92 g/mol. Its IUPAC name is N-[3,5-bis(3-propylsulfanylpropanoylamino)-1-adamantyl]-3-propylsulfanylpropanamide.
Molecular Properties
| Compound Name | N-[3,5-bis(3-propylsulfanylpropanoylamino)-1-adamantyl]-3-propylsulfanylpropanamide |
| PubChem CID | 176584947 |
| Molecular Formula | C28H49N3O3S3 |
| Molecular Weight | 571.92 g/mol |
| Exact Mass | 571.29 |
| IUPAC Name | N-[3,5-bis(3-propylsulfanylpropanoylamino)-1-adamantyl]-3-propylsulfanylpropanamide |
| SMILES | CCCSCCC(=O)NC12CC3CC(NC(=O)CCSCCC)(C1)CC(NC(=O)CCSCCC)(C3)C2 |
| InChI | InChI=1S/C28H49N3O3S3/c1-4-10-35-13-7-23(32)29-26-16-22-17-27(19-26,30-24(33)8-14-36-11-5-2)21-28(18-22,20-26)31-25(34)9-15-37-12-6-3/h22H,4-21H2,1-3H3,(H,29,32)(H,30,33)(H,31,34) |
| InChIKey | OKSYHQBHNOTSAA-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 571.92 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3,5-bis(3-propylsulfanylpropanoylamino)-1-adamantyl]-3-propylsulfanylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3,5-bis(3-propylsulfanylpropanoylamino)-1-adamantyl]-3-propylsulfanylpropanamide?
The IUPAC name of N-[3,5-bis(3-propylsulfanylpropanoylamino)-1-adamantyl]-3-propylsulfanylpropanamide (CID 176584947) is N-[3,5-bis(3-propylsulfanylpropanoylamino)-1-adamantyl]-3-propylsulfanylpropanamide.
What is the SMILES notation for N-[3,5-bis(3-propylsulfanylpropanoylamino)-1-adamantyl]-3-propylsulfanylpropanamide?
The canonical SMILES for N-[3,5-bis(3-propylsulfanylpropanoylamino)-1-adamantyl]-3-propylsulfanylpropanamide is CCCSCCC(=O)NC12CC3CC(NC(=O)CCSCCC)(C1)CC(NC(=O)CCSCCC)(C3)C2.
What is the InChIKey of N-[3,5-bis(3-propylsulfanylpropanoylamino)-1-adamantyl]-3-propylsulfanylpropanamide?
The InChIKey is OKSYHQBHNOTSAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H49N3O3S3/c1-4-10-35-13-7-23(32)29-26-16-22-17-27(19-26,30-24(33)8-14-36-11-5-2)21-28(18-22,20-26)31-25(34)9-15-37-12-6-3/h22H,4-21H2,1-3H3,(H,29,32)(H,30,33)(H,31,34).
What are the key properties of N-[3,5-bis(3-propylsulfanylpropanoylamino)-1-adamantyl]-3-propylsulfanylpropanamide?
N-[3,5-bis(3-propylsulfanylpropanoylamino)-1-adamantyl]-3-propylsulfanylpropanamide has a molecular weight of 571.92 g/mol, XLogP of 5.15, 18 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3,5-bis(3-propylsulfanylpropanoylamino)-1-adamantyl]-3-propylsulfanylpropanamide is sourced from PubChem (CID 176584947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).