About N-[3,5-bis[(2-ethylsulfanylacetyl)amino]-1-adamantyl]-2-ethylsulfanylacetamide
N-[3,5-bis[(2-ethylsulfanylacetyl)amino]-1-adamantyl]-2-ethylsulfanylacetamide (PubChem CID 176584956) has the molecular formula C22H37N3O3S3
and a molecular weight of 487.76 g/mol. Its IUPAC name is N-[3,5-bis[(2-ethylsulfanylacetyl)amino]-1-adamantyl]-2-ethylsulfanylacetamide.
Molecular Properties
| Compound Name | N-[3,5-bis[(2-ethylsulfanylacetyl)amino]-1-adamantyl]-2-ethylsulfanylacetamide |
| PubChem CID | 176584956 |
| Molecular Formula | C22H37N3O3S3 |
| Molecular Weight | 487.76 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | N-[3,5-bis[(2-ethylsulfanylacetyl)amino]-1-adamantyl]-2-ethylsulfanylacetamide |
| SMILES | CCSCC(=O)NC12CC3CC(NC(=O)CSCC)(C1)CC(NC(=O)CSCC)(C3)C2 |
| InChI | InChI=1S/C22H37N3O3S3/c1-4-29-10-17(26)23-20-7-16-8-21(13-20,24-18(27)11-30-5-2)15-22(9-16,14-20)25-19(28)12-31-6-3/h16H,4-15H2,1-3H3,(H,23,26)(H,24,27)(H,25,28) |
| InChIKey | LMYGFPQFNPWKRU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 487.76 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[3,5-bis[(2-ethylsulfanylacetyl)amino]-1-adamantyl]-2-ethylsulfanylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3,5-bis[(2-ethylsulfanylacetyl)amino]-1-adamantyl]-2-ethylsulfanylacetamide?
The IUPAC name of N-[3,5-bis[(2-ethylsulfanylacetyl)amino]-1-adamantyl]-2-ethylsulfanylacetamide (CID 176584956) is N-[3,5-bis[(2-ethylsulfanylacetyl)amino]-1-adamantyl]-2-ethylsulfanylacetamide.
What is the SMILES notation for N-[3,5-bis[(2-ethylsulfanylacetyl)amino]-1-adamantyl]-2-ethylsulfanylacetamide?
The canonical SMILES for N-[3,5-bis[(2-ethylsulfanylacetyl)amino]-1-adamantyl]-2-ethylsulfanylacetamide is CCSCC(=O)NC12CC3CC(NC(=O)CSCC)(C1)CC(NC(=O)CSCC)(C3)C2.
What is the InChIKey of N-[3,5-bis[(2-ethylsulfanylacetyl)amino]-1-adamantyl]-2-ethylsulfanylacetamide?
The InChIKey is LMYGFPQFNPWKRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H37N3O3S3/c1-4-29-10-17(26)23-20-7-16-8-21(13-20,24-18(27)11-30-5-2)15-22(9-16,14-20)25-19(28)12-31-6-3/h16H,4-15H2,1-3H3,(H,23,26)(H,24,27)(H,25,28).
What are the key properties of N-[3,5-bis[(2-ethylsulfanylacetyl)amino]-1-adamantyl]-2-ethylsulfanylacetamide?
N-[3,5-bis[(2-ethylsulfanylacetyl)amino]-1-adamantyl]-2-ethylsulfanylacetamide has a molecular weight of 487.76 g/mol, XLogP of 2.81, 12 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3,5-bis[(2-ethylsulfanylacetyl)amino]-1-adamantyl]-2-ethylsulfanylacetamide is sourced from PubChem (CID 176584956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).