C22H19F4N5O2 — CID 176585160
propan-2-yl (E)-3-[3-[2-cyclopropyl-6-(trifluoromethyl)-4-pyridinyl]-1,2,4-triazol-1-yl]-2-(6-fluoro-2-pyridinyl)prop-2-enoate (PubChem CID 176585160) has the molecular formula C22H19F4N5O2 and a molecular weight of 461.42 g/mol. Its IUPAC name is propan-2-yl (E)-3-[3-[2-cyclopropyl-6-(trifluoromethyl)-4-pyridinyl]-1,2,4-triazol-1-yl]-2-(6-fluoro-2-pyridinyl)prop-2-enoate.
| Compound Name | propan-2-yl (E)-3-[3-[2-cyclopropyl-6-(trifluoromethyl)-4-pyridinyl]-1,2,4-triazol-1-yl]-2-(6-fluoro-2-pyridinyl)prop-2-enoate |
|---|---|
| PubChem CID | 176585160 |
| Molecular Formula | C22H19F4N5O2 |
| Molecular Weight | 461.42 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | propan-2-yl (E)-3-[3-[2-cyclopropyl-6-(trifluoromethyl)-4-pyridinyl]-1,2,4-triazol-1-yl]-2-(6-fluoro-2-pyridinyl)prop-2-enoate |
| SMILES | CC(C)OC(=O)/C(=C/n1cnc(-c2cc(C3CC3)nc(C(F)(F)F)c2)n1)c1cccc(F)n1 |
| InChI | InChI=1S/C22H19F4N5O2/c1-12(2)33-21(32)15(16-4-3-5-19(23)29-16)10-31-11-27-20(30-31)14-8-17(13-6-7-13)28-18(9-14)22(24,25)26/h3-5,8-13H,6-7H2,1-2H3/b15-10+ |
| InChIKey | MLVGYRJMBAXANX-XNTDXEJSSA-N |
| XLogP | 4.72 |
| TPSA | 82.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.42 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|