C11H8N4OS4 — CID 176585376
N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-2-thiophen-2-yl-1,3-thiazole-5-carboxamide (PubChem CID 176585376) has the molecular formula C11H8N4OS4 and a molecular weight of 340.48 g/mol. Its IUPAC name is N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-2-thiophen-2-yl-1,3-thiazole-5-carboxamide.
| Compound Name | N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-2-thiophen-2-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 176585376 |
| Molecular Formula | C11H8N4OS4 |
| Molecular Weight | 340.48 g/mol |
| Exact Mass | 339.96 |
| IUPAC Name | N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-2-thiophen-2-yl-1,3-thiazole-5-carboxamide |
| SMILES | CSc1nnc(NC(=O)c2cnc(-c3cccs3)s2)s1 |
| InChI | InChI=1S/C11H8N4OS4/c1-17-11-15-14-10(20-11)13-8(16)7-5-12-9(19-7)6-3-2-4-18-6/h2-5H,1H3,(H,13,14,16) |
| InChIKey | PYOAJJFVWBDCSW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|