About 1-N,1-N-bis(4-bromophenyl)-2-N-methyl-3-piperazin-1-ylpropane-1,2-diamine
1-N,1-N-bis(4-bromophenyl)-2-N-methyl-3-piperazin-1-ylpropane-1,2-diamine (PubChem CID 176586340) has the molecular formula C20H26Br2N4
and a molecular weight of 482.26 g/mol. Its IUPAC name is 1-N,1-N-bis(4-bromophenyl)-2-N-methyl-3-piperazin-1-ylpropane-1,2-diamine.
Molecular Properties
| Compound Name | 1-N,1-N-bis(4-bromophenyl)-2-N-methyl-3-piperazin-1-ylpropane-1,2-diamine |
| PubChem CID | 176586340 |
| Molecular Formula | C20H26Br2N4 |
| Molecular Weight | 482.26 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | 1-N,1-N-bis(4-bromophenyl)-2-N-methyl-3-piperazin-1-ylpropane-1,2-diamine |
| SMILES | CNC(CN1CCNCC1)CN(c1ccc(Br)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H26Br2N4/c1-23-18(14-25-12-10-24-11-13-25)15-26(19-6-2-16(21)3-7-19)20-8-4-17(22)5-9-20/h2-9,18,23-24H,10-15H2,1H3 |
| InChIKey | YBBDZTMMPGINBD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 482.26 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-N,1-N-bis(4-bromophenyl)-2-N-methyl-3-piperazin-1-ylpropane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,1-N-bis(4-bromophenyl)-2-N-methyl-3-piperazin-1-ylpropane-1,2-diamine?
The IUPAC name of 1-N,1-N-bis(4-bromophenyl)-2-N-methyl-3-piperazin-1-ylpropane-1,2-diamine (CID 176586340) is 1-N,1-N-bis(4-bromophenyl)-2-N-methyl-3-piperazin-1-ylpropane-1,2-diamine.
What is the SMILES notation for 1-N,1-N-bis(4-bromophenyl)-2-N-methyl-3-piperazin-1-ylpropane-1,2-diamine?
The canonical SMILES for 1-N,1-N-bis(4-bromophenyl)-2-N-methyl-3-piperazin-1-ylpropane-1,2-diamine is CNC(CN1CCNCC1)CN(c1ccc(Br)cc1)c1ccc(Br)cc1.
What is the InChIKey of 1-N,1-N-bis(4-bromophenyl)-2-N-methyl-3-piperazin-1-ylpropane-1,2-diamine?
The InChIKey is YBBDZTMMPGINBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26Br2N4/c1-23-18(14-25-12-10-24-11-13-25)15-26(19-6-2-16(21)3-7-19)20-8-4-17(22)5-9-20/h2-9,18,23-24H,10-15H2,1H3.
What are the key properties of 1-N,1-N-bis(4-bromophenyl)-2-N-methyl-3-piperazin-1-ylpropane-1,2-diamine?
1-N,1-N-bis(4-bromophenyl)-2-N-methyl-3-piperazin-1-ylpropane-1,2-diamine has a molecular weight of 482.26 g/mol, XLogP of 3.84, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,1-N-bis(4-bromophenyl)-2-N-methyl-3-piperazin-1-ylpropane-1,2-diamine is sourced from PubChem (CID 176586340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).