C55H37N5 — CID 176586529
2,4,6-tris[3-(3-pyridin-3-ylphenyl)phenyl]pyrimidine (PubChem CID 176586529) has the molecular formula C55H37N5 and a molecular weight of 767.94 g/mol. Its IUPAC name is 2,4,6-tris[3-(3-pyridin-3-ylphenyl)phenyl]pyrimidine.
| Compound Name | 2,4,6-tris[3-(3-pyridin-3-ylphenyl)phenyl]pyrimidine |
|---|---|
| PubChem CID | 176586529 |
| Molecular Formula | C55H37N5 |
| Molecular Weight | 767.94 g/mol |
| Exact Mass | 767.30 |
| IUPAC Name | 2,4,6-tris[3-(3-pyridin-3-ylphenyl)phenyl]pyrimidine |
| SMILES | c1cncc(-c2cccc(-c3cccc(-c4cc(-c5cccc(-c6cccc(-c7cccnc7)c6)c5)nc(-c5cccc(-c6cccc(-c7cccnc7)c6)c5)n4)c3)c2)c1 |
| InChI | InChI=1S/C55H37N5/c1-10-38(28-44(16-1)50-22-7-25-56-35-50)41-13-4-19-47(31-41)53-34-54(48-20-5-14-42(32-48)39-11-2-17-45(29-39)51-23-8-26-57-36-51)60-55(59-53)49-21-6-15-43(33-49)40-12-3-18-46(30-40)52-24-9-27-58-37-52/h1-37H |
| InChIKey | UKJNDQWKRAHZBB-UHFFFAOYSA-N |
| XLogP | 13.66 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.94 |
| LogP ≤ 5 | 13.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |