C6H11O2PS3 — CID 176588648
oxo-sulfido-[(4S,5S)-3,3,5-trimethyldithiolan-4-yl]oxyphosphanium (PubChem CID 176588648) has the molecular formula C6H11O2PS3 and a molecular weight of 242.33 g/mol. Its IUPAC name is oxo-sulfido-[(4S,5S)-3,3,5-trimethyldithiolan-4-yl]oxyphosphanium.
| Compound Name | oxo-sulfido-[(4S,5S)-3,3,5-trimethyldithiolan-4-yl]oxyphosphanium |
|---|---|
| PubChem CID | 176588648 |
| Molecular Formula | C6H11O2PS3 |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 241.97 |
| IUPAC Name | oxo-sulfido-[(4S,5S)-3,3,5-trimethyldithiolan-4-yl]oxyphosphanium |
| SMILES | C[C@@H]1SSC(C)(C)[C@H]1O[P+](=O)[S-] |
| InChI | InChI=1S/C6H11O2PS3/c1-4-5(8-9(7)10)6(2,3)12-11-4/h4-5H,1-3H3/t4-,5-/m0/s1 |
| InChIKey | OVVJMZPHRYKVKG-WHFBIAKZSA-N |
| XLogP | 3.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|