C90H94 — CID 176589189
1,4-bis[3,5-bis(2-tert-butylphenyl)phenyl]-2,5-bis[2-(2-tert-butylphenyl)phenyl]-3,6-dideuteriobenzene (PubChem CID 176589189) has the molecular formula C90H94 and a molecular weight of 1177.75 g/mol. Its IUPAC name is 1,4-bis[3,5-bis(2-tert-butylphenyl)phenyl]-2,5-bis[2-(2-tert-butylphenyl)phenyl]-3,6-dideuteriobenzene.
| Compound Name | 1,4-bis[3,5-bis(2-tert-butylphenyl)phenyl]-2,5-bis[2-(2-tert-butylphenyl)phenyl]-3,6-dideuteriobenzene |
|---|---|
| PubChem CID | 176589189 |
| Molecular Formula | C90H94 |
| Molecular Weight | 1177.75 g/mol |
| Exact Mass | 1176.75 |
| IUPAC Name | 1,4-bis[3,5-bis(2-tert-butylphenyl)phenyl]-2,5-bis[2-(2-tert-butylphenyl)phenyl]-3,6-dideuteriobenzene |
| SMILES | [2H]c1c(-c2cc(-c3ccccc3C(C)(C)C)cc(-c3ccccc3C(C)(C)C)c2)c(-c2ccccc2-c2ccccc2C(C)(C)C)c([2H])c(-c2cc(-c3ccccc3C(C)(C)C)cc(-c3ccccc3C(C)(C)C)c2)c1-c1ccccc1-c1ccccc1C(C)(C)C |
| InChI | InChI=1S/C90H94/c1-85(2,3)79-45-29-23-35-65(79)59-51-60(66-36-24-30-46-80(66)86(4,5)6)54-63(53-59)75-57-78(72-42-22-20-40-70(72)74-44-28-34-50-84(74)90(16,17)18)76(58-77(75)71-41-21-19-39-69(71)73-43-27-33-49-83(73)89(13,14)15)64-55-61(67-37-25-31-47-81(67)87(7,8)9)52-62(56-64)68-38-26-32-48-82(68)88(10,11)12/h19-58H,1-18H3/i57D,58D |
| InChIKey | OZNGNFGAENTAMP-OHYKBVSRSA-N |
| XLogP | 26.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 90 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1177.75 |
| LogP ≤ 5 | 26.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |