C23H34N2O3 — CID 176590084
1-[6-(3,3-dimethyl-2,5-dimethylidene-6-oxopiperidin-1-yl)hexyl]-3,3-dimethyl-5-methylidenepiperidine-2,6-dione (PubChem CID 176590084) has the molecular formula C23H34N2O3 and a molecular weight of 386.54 g/mol. Its IUPAC name is 1-[6-(3,3-dimethyl-2,5-dimethylidene-6-oxopiperidin-1-yl)hexyl]-3,3-dimethyl-5-methylidenepiperidine-2,6-dione.
| Compound Name | 1-[6-(3,3-dimethyl-2,5-dimethylidene-6-oxopiperidin-1-yl)hexyl]-3,3-dimethyl-5-methylidenepiperidine-2,6-dione |
|---|---|
| PubChem CID | 176590084 |
| Molecular Formula | C23H34N2O3 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.26 |
| IUPAC Name | 1-[6-(3,3-dimethyl-2,5-dimethylidene-6-oxopiperidin-1-yl)hexyl]-3,3-dimethyl-5-methylidenepiperidine-2,6-dione |
| SMILES | C=C1CC(C)(C)C(=C)N(CCCCCCN2C(=O)C(=C)CC(C)(C)C2=O)C1=O |
| InChI | InChI=1S/C23H34N2O3/c1-16-14-22(4,5)18(3)24(19(16)26)12-10-8-9-11-13-25-20(27)17(2)15-23(6,7)21(25)28/h1-3,8-15H2,4-7H3 |
| InChIKey | CGWHGYKUTVKXOI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|