C28H38F12O11 — CID 176591334
3-[2-[3,3,4,4,5,5-hexafluoro-2-[2-[2-[2-[2-[3,3,4,4,5,5-hexafluoro-2-[2-(2-methoxyethoxy)ethoxy]cyclopenten-1-yl]oxyethoxy]ethoxy]ethoxy]ethoxy]cyclopenten-1-yl]oxyethoxy]propan-1-ol (PubChem CID 176591334) has the molecular formula C28H38F12O11 and a molecular weight of 778.58 g/mol. Its IUPAC name is 3-[2-[3,3,4,4,5,5-hexafluoro-2-[2-[2-[2-[2-[3,3,4,4,5,5-hexafluoro-2-[2-(2-methoxyethoxy)ethoxy]cyclopenten-1-yl]oxyethoxy]ethoxy]ethoxy]ethoxy]cyclopenten-1-yl]oxyethoxy]propan-1-ol.
| Compound Name | 3-[2-[3,3,4,4,5,5-hexafluoro-2-[2-[2-[2-[2-[3,3,4,4,5,5-hexafluoro-2-[2-(2-methoxyethoxy)ethoxy]cyclopenten-1-yl]oxyethoxy]ethoxy]ethoxy]ethoxy]cyclopenten-1-yl]oxyethoxy]propan-1-ol |
|---|---|
| PubChem CID | 176591334 |
| Molecular Formula | C28H38F12O11 |
| Molecular Weight | 778.58 g/mol |
| Exact Mass | 778.22 |
| IUPAC Name | 3-[2-[3,3,4,4,5,5-hexafluoro-2-[2-[2-[2-[2-[3,3,4,4,5,5-hexafluoro-2-[2-(2-methoxyethoxy)ethoxy]cyclopenten-1-yl]oxyethoxy]ethoxy]ethoxy]ethoxy]cyclopenten-1-yl]oxyethoxy]propan-1-ol |
| SMILES | COCCOCCOC1=C(OCCOCCOCCOCCOC2=C(OCCOCCCO)C(F)(F)C(F)(F)C2(F)F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C28H38F12O11/c1-42-5-6-44-12-16-49-21-22(26(35,36)28(39,40)25(21,33)34)51-18-14-47-10-8-45-7-9-46-13-17-50-20-19(48-15-11-43-4-2-3-41)23(29,30)27(37,38)24(20,31)32/h41H,2-18H2,1H3 |
| InChIKey | MUWPQASDXFRHGD-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.58 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|