C36H35ClFN9O3 — CID 176591440
9-[[5-[(3R)-3-amino-3-(6-chloro-2-pyridinyl)piperidin-1-yl]-2-[3-fluoro-4-(phenylmethoxymethoxy)phenyl]-3-methoxy-4-pyridinyl]methyl]purin-6-amine (PubChem CID 176591440) has the molecular formula C36H35ClFN9O3 and a molecular weight of 696.19 g/mol. Its IUPAC name is 9-[[5-[(3R)-3-amino-3-(6-chloro-2-pyridinyl)piperidin-1-yl]-2-[3-fluoro-4-(phenylmethoxymethoxy)phenyl]-3-methoxy-4-pyridinyl]methyl]purin-6-amine.
| Compound Name | 9-[[5-[(3R)-3-amino-3-(6-chloro-2-pyridinyl)piperidin-1-yl]-2-[3-fluoro-4-(phenylmethoxymethoxy)phenyl]-3-methoxy-4-pyridinyl]methyl]purin-6-amine |
|---|---|
| PubChem CID | 176591440 |
| Molecular Formula | C36H35ClFN9O3 |
| Molecular Weight | 696.19 g/mol |
| Exact Mass | 695.25 |
| IUPAC Name | 9-[[5-[(3R)-3-amino-3-(6-chloro-2-pyridinyl)piperidin-1-yl]-2-[3-fluoro-4-(phenylmethoxymethoxy)phenyl]-3-methoxy-4-pyridinyl]methyl]purin-6-amine |
| SMILES | COc1c(-c2ccc(OCOCc3ccccc3)c(F)c2)ncc(N2CCC[C@](N)(c3cccc(Cl)n3)C2)c1Cn1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C36H35ClFN9O3/c1-48-33-25(17-47-21-44-32-34(39)42-20-43-35(32)47)27(46-14-6-13-36(40,19-46)29-9-5-10-30(37)45-29)16-41-31(33)24-11-12-28(26(38)15-24)50-22-49-18-23-7-3-2-4-8-23/h2-5,7-12,15-16,20-21H,6,13-14,17-19,22,40H2,1H3,(H2,39,42,43)/t36-/m1/s1 |
| InChIKey | WYFWCQFLLNGJOA-PSXMRANNSA-N |
| XLogP | 5.72 |
| TPSA | 152.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.19 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|