C32H35ClF2N9O4P — CID 176591447
N-[9-[[5-[(3R)-3-amino-3-(6-chloro-2-pyridinyl)piperidin-1-yl]-2-(2,5-difluoro-4-methoxyphenyl)-4-pyridinyl]methyl]purin-6-yl]-butan-2-yloxyphosphonamidic acid (PubChem CID 176591447) has the molecular formula C32H35ClF2N9O4P and a molecular weight of 714.11 g/mol. Its IUPAC name is N-[9-[[5-[(3R)-3-amino-3-(6-chloro-2-pyridinyl)piperidin-1-yl]-2-(2,5-difluoro-4-methoxyphenyl)-4-pyridinyl]methyl]purin-6-yl]-butan-2-yloxyphosphonamidic acid.
| Compound Name | N-[9-[[5-[(3R)-3-amino-3-(6-chloro-2-pyridinyl)piperidin-1-yl]-2-(2,5-difluoro-4-methoxyphenyl)-4-pyridinyl]methyl]purin-6-yl]-butan-2-yloxyphosphonamidic acid |
|---|---|
| PubChem CID | 176591447 |
| Molecular Formula | C32H35ClF2N9O4P |
| Molecular Weight | 714.11 g/mol |
| Exact Mass | 713.22 |
| IUPAC Name | N-[9-[[5-[(3R)-3-amino-3-(6-chloro-2-pyridinyl)piperidin-1-yl]-2-(2,5-difluoro-4-methoxyphenyl)-4-pyridinyl]methyl]purin-6-yl]-butan-2-yloxyphosphonamidic acid |
| SMILES | CCC(C)OP(=O)(O)Nc1ncnc2c1ncn2Cc1cc(-c2cc(F)c(OC)cc2F)ncc1N1CCC[C@](N)(c2cccc(Cl)n2)C1 |
| InChI | InChI=1S/C32H35ClF2N9O4P/c1-4-19(2)48-49(45,46)42-30-29-31(39-17-38-30)44(18-40-29)15-20-11-24(21-12-23(35)26(47-3)13-22(21)34)37-14-25(20)43-10-6-9-32(36,16-43)27-7-5-8-28(33)41-27/h5,7-8,11-14,17-19H,4,6,9-10,15-16,36H2,1-3H3,(H2,38,39,42,45,46)/t19?,32-/m1/s1 |
| InChIKey | PILOUTGEYHBNGU-NJBKGMLESA-N |
| XLogP | 6.05 |
| TPSA | 166.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.11 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|