C32H35ClF2N9O4P — CID 176591509
[4-[5-[(3R)-3-amino-3-(6-chloro-2-pyridinyl)piperidin-1-yl]-4-[(6-aminopurin-9-yl)methyl]-2-pyridinyl]-2,5-difluorophenoxy]methyl-butan-2-yloxyphosphinic acid (PubChem CID 176591509) has the molecular formula C32H35ClF2N9O4P and a molecular weight of 714.11 g/mol. Its IUPAC name is [4-[5-[(3R)-3-amino-3-(6-chloro-2-pyridinyl)piperidin-1-yl]-4-[(6-aminopurin-9-yl)methyl]-2-pyridinyl]-2,5-difluorophenoxy]methyl-butan-2-yloxyphosphinic acid.
| Compound Name | [4-[5-[(3R)-3-amino-3-(6-chloro-2-pyridinyl)piperidin-1-yl]-4-[(6-aminopurin-9-yl)methyl]-2-pyridinyl]-2,5-difluorophenoxy]methyl-butan-2-yloxyphosphinic acid |
|---|---|
| PubChem CID | 176591509 |
| Molecular Formula | C32H35ClF2N9O4P |
| Molecular Weight | 714.11 g/mol |
| Exact Mass | 713.22 |
| IUPAC Name | [4-[5-[(3R)-3-amino-3-(6-chloro-2-pyridinyl)piperidin-1-yl]-4-[(6-aminopurin-9-yl)methyl]-2-pyridinyl]-2,5-difluorophenoxy]methyl-butan-2-yloxyphosphinic acid |
| SMILES | CCC(C)OP(=O)(O)COc1cc(F)c(-c2cc(Cn3cnc4c(N)ncnc43)c(N3CCC[C@](N)(c4cccc(Cl)n4)C3)cn2)cc1F |
| InChI | InChI=1S/C32H35ClF2N9O4P/c1-3-19(2)48-49(45,46)18-47-26-12-22(34)21(11-23(26)35)24-10-20(14-44-17-41-29-30(36)39-16-40-31(29)44)25(13-38-24)43-9-5-8-32(37,15-43)27-6-4-7-28(33)42-27/h4,6-7,10-13,16-17,19H,3,5,8-9,14-15,18,37H2,1-2H3,(H,45,46)(H2,36,39,40)/t19?,32-/m1/s1 |
| InChIKey | UMMLPBCYDZPGQF-NJBKGMLESA-N |
| XLogP | 5.64 |
| TPSA | 180.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.11 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|