C36H33F5N9O4P — CID 176591604
9-[[5-[(3S)-3-amino-3-(2,2-difluoroethyl)piperidin-1-yl]-2-[5-[bis(4-fluorophenoxy)phosphorylmethoxy]-6-fluoro-2-pyridinyl]-4-pyridinyl]methyl]purin-6-amine (PubChem CID 176591604) has the molecular formula C36H33F5N9O4P and a molecular weight of 781.68 g/mol. Its IUPAC name is 9-[[5-[(3S)-3-amino-3-(2,2-difluoroethyl)piperidin-1-yl]-2-[5-[bis(4-fluorophenoxy)phosphorylmethoxy]-6-fluoro-2-pyridinyl]-4-pyridinyl]methyl]purin-6-amine.
| Compound Name | 9-[[5-[(3S)-3-amino-3-(2,2-difluoroethyl)piperidin-1-yl]-2-[5-[bis(4-fluorophenoxy)phosphorylmethoxy]-6-fluoro-2-pyridinyl]-4-pyridinyl]methyl]purin-6-amine |
|---|---|
| PubChem CID | 176591604 |
| Molecular Formula | C36H33F5N9O4P |
| Molecular Weight | 781.68 g/mol |
| Exact Mass | 781.23 |
| IUPAC Name | 9-[[5-[(3S)-3-amino-3-(2,2-difluoroethyl)piperidin-1-yl]-2-[5-[bis(4-fluorophenoxy)phosphorylmethoxy]-6-fluoro-2-pyridinyl]-4-pyridinyl]methyl]purin-6-amine |
| SMILES | Nc1ncnc2c1ncn2Cc1cc(-c2ccc(OCP(=O)(Oc3ccc(F)cc3)Oc3ccc(F)cc3)c(F)n2)ncc1N1CCC[C@](N)(CC(F)F)C1 |
| InChI | InChI=1S/C36H33F5N9O4P/c37-23-2-6-25(7-3-23)53-55(51,54-26-8-4-24(38)5-9-26)21-52-30-11-10-27(48-33(30)41)28-14-22(17-50-20-47-32-34(42)45-19-46-35(32)50)29(16-44-28)49-13-1-12-36(43,18-49)15-31(39)40/h2-11,14,16,19-20,31H,1,12-13,15,17-18,21,43H2,(H2,42,45,46)/t36-/m0/s1 |
| InChIKey | XRIJMTCCFHRTLQ-BHVANESWSA-N |
| XLogP | 6.97 |
| TPSA | 169.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.68 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|