C35H31Cl2F3N9O5P — CID 176591676
[6-[5-[(3R)-3-amino-3-[(1R)-2,2-difluoro-1-hydroxyethyl]piperidin-1-yl]-4-[(6-aminopurin-9-yl)methyl]-2-pyridinyl]-2-fluoro-3-pyridinyl] bis(4-chlorophenyl) phosphate (PubChem CID 176591676) has the molecular formula C35H31Cl2F3N9O5P and a molecular weight of 816.56 g/mol. Its IUPAC name is [6-[5-[(3R)-3-amino-3-[(1R)-2,2-difluoro-1-hydroxyethyl]piperidin-1-yl]-4-[(6-aminopurin-9-yl)methyl]-2-pyridinyl]-2-fluoro-3-pyridinyl] bis(4-chlorophenyl) phosphate.
| Compound Name | [6-[5-[(3R)-3-amino-3-[(1R)-2,2-difluoro-1-hydroxyethyl]piperidin-1-yl]-4-[(6-aminopurin-9-yl)methyl]-2-pyridinyl]-2-fluoro-3-pyridinyl] bis(4-chlorophenyl) phosphate |
|---|---|
| PubChem CID | 176591676 |
| Molecular Formula | C35H31Cl2F3N9O5P |
| Molecular Weight | 816.56 g/mol |
| Exact Mass | 815.15 |
| IUPAC Name | [6-[5-[(3R)-3-amino-3-[(1R)-2,2-difluoro-1-hydroxyethyl]piperidin-1-yl]-4-[(6-aminopurin-9-yl)methyl]-2-pyridinyl]-2-fluoro-3-pyridinyl] bis(4-chlorophenyl) phosphate |
| SMILES | Nc1ncnc2c1ncn2Cc1cc(-c2ccc(OP(=O)(Oc3ccc(Cl)cc3)Oc3ccc(Cl)cc3)c(F)n2)ncc1N1CCC[C@](N)([C@@H](O)C(F)F)C1 |
| InChI | InChI=1S/C35H31Cl2F3N9O5P/c36-21-2-6-23(7-3-21)52-55(51,53-24-8-4-22(37)5-9-24)54-28-11-10-25(47-32(28)40)26-14-20(16-49-19-46-29-33(41)44-18-45-34(29)49)27(15-43-26)48-13-1-12-35(42,17-48)30(50)31(38)39/h2-11,14-15,18-19,30-31,50H,1,12-13,16-17,42H2,(H2,41,44,45)/t30-,35+/m0/s1 |
| InChIKey | MSCMDJVETMSURZ-LWQYYNMXSA-N |
| XLogP | 6.93 |
| TPSA | 189.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.56 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|