About 5,6-dibromo-3-methylthieno[3,2-b]thiophene
5,6-dibromo-3-methylthieno[3,2-b]thiophene (PubChem CID 176591761) has the molecular formula C7H4Br2S2
and a molecular weight of 312.05 g/mol. Its IUPAC name is 5,6-dibromo-3-methylthieno[3,2-b]thiophene.
Molecular Properties
| Compound Name | 5,6-dibromo-3-methylthieno[3,2-b]thiophene |
| PubChem CID | 176591761 |
| Molecular Formula | C7H4Br2S2 |
| Molecular Weight | 312.05 g/mol |
| Exact Mass | 309.81 |
| IUPAC Name | 5,6-dibromo-3-methylthieno[3,2-b]thiophene |
| SMILES | Cc1csc2c(Br)c(Br)sc12 |
| InChI | InChI=1S/C7H4Br2S2/c1-3-2-10-6-4(8)7(9)11-5(3)6/h2H,1H3 |
| InChIKey | XWPVJFULUGZTJN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.05 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,6-dibromo-3-methylthieno[3,2-b]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dibromo-3-methylthieno[3,2-b]thiophene?
The IUPAC name of 5,6-dibromo-3-methylthieno[3,2-b]thiophene (CID 176591761) is 5,6-dibromo-3-methylthieno[3,2-b]thiophene.
What is the SMILES notation for 5,6-dibromo-3-methylthieno[3,2-b]thiophene?
The canonical SMILES for 5,6-dibromo-3-methylthieno[3,2-b]thiophene is Cc1csc2c(Br)c(Br)sc12.
What is the InChIKey of 5,6-dibromo-3-methylthieno[3,2-b]thiophene?
The InChIKey is XWPVJFULUGZTJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4Br2S2/c1-3-2-10-6-4(8)7(9)11-5(3)6/h2H,1H3.
What are the key properties of 5,6-dibromo-3-methylthieno[3,2-b]thiophene?
5,6-dibromo-3-methylthieno[3,2-b]thiophene has a molecular weight of 312.05 g/mol, XLogP of 4.80, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dibromo-3-methylthieno[3,2-b]thiophene is sourced from PubChem (CID 176591761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).