About 2,6-dichloro-9-[(1R,5R)-3-oxabicyclo[3.1.0]hexan-1-yl]-7-propan-2-ylpurin-8-one
2,6-dichloro-9-[(1R,5R)-3-oxabicyclo[3.1.0]hexan-1-yl]-7-propan-2-ylpurin-8-one (PubChem CID 176593793) has the molecular formula C13H14Cl2N4O2
and a molecular weight of 329.19 g/mol. Its IUPAC name is 2,6-dichloro-9-[(1R,5R)-3-oxabicyclo[3.1.0]hexan-1-yl]-7-propan-2-ylpurin-8-one.
Molecular Properties
| Compound Name | 2,6-dichloro-9-[(1R,5R)-3-oxabicyclo[3.1.0]hexan-1-yl]-7-propan-2-ylpurin-8-one |
| PubChem CID | 176593793 |
| Molecular Formula | C13H14Cl2N4O2 |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 2,6-dichloro-9-[(1R,5R)-3-oxabicyclo[3.1.0]hexan-1-yl]-7-propan-2-ylpurin-8-one |
| SMILES | CC(C)n1c(=O)n([C@@]23COC[C@@H]2C3)c2nc(Cl)nc(Cl)c21 |
| InChI | InChI=1S/C13H14Cl2N4O2/c1-6(2)18-8-9(14)16-11(15)17-10(8)19(12(18)20)13-3-7(13)4-21-5-13/h6-7H,3-5H2,1-2H3/t7-,13-/m0/s1 |
| InChIKey | LPOQERPVQNZVCK-CPFSXVBKSA-N |
| XLogP | 2.23 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2,6-dichloro-9-[(1R,5R)-3-oxabicyclo[3.1.0]hexan-1-yl]-7-propan-2-ylpurin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dichloro-9-[(1R,5R)-3-oxabicyclo[3.1.0]hexan-1-yl]-7-propan-2-ylpurin-8-one?
The IUPAC name of 2,6-dichloro-9-[(1R,5R)-3-oxabicyclo[3.1.0]hexan-1-yl]-7-propan-2-ylpurin-8-one (CID 176593793) is 2,6-dichloro-9-[(1R,5R)-3-oxabicyclo[3.1.0]hexan-1-yl]-7-propan-2-ylpurin-8-one.
What is the SMILES notation for 2,6-dichloro-9-[(1R,5R)-3-oxabicyclo[3.1.0]hexan-1-yl]-7-propan-2-ylpurin-8-one?
The canonical SMILES for 2,6-dichloro-9-[(1R,5R)-3-oxabicyclo[3.1.0]hexan-1-yl]-7-propan-2-ylpurin-8-one is CC(C)n1c(=O)n([C@@]23COC[C@@H]2C3)c2nc(Cl)nc(Cl)c21.
What is the InChIKey of 2,6-dichloro-9-[(1R,5R)-3-oxabicyclo[3.1.0]hexan-1-yl]-7-propan-2-ylpurin-8-one?
The InChIKey is LPOQERPVQNZVCK-CPFSXVBKSA-N. The full InChI is InChI=1S/C13H14Cl2N4O2/c1-6(2)18-8-9(14)16-11(15)17-10(8)19(12(18)20)13-3-7(13)4-21-5-13/h6-7H,3-5H2,1-2H3/t7-,13-/m0/s1.
What are the key properties of 2,6-dichloro-9-[(1R,5R)-3-oxabicyclo[3.1.0]hexan-1-yl]-7-propan-2-ylpurin-8-one?
2,6-dichloro-9-[(1R,5R)-3-oxabicyclo[3.1.0]hexan-1-yl]-7-propan-2-ylpurin-8-one has a molecular weight of 329.19 g/mol, XLogP of 2.23, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dichloro-9-[(1R,5R)-3-oxabicyclo[3.1.0]hexan-1-yl]-7-propan-2-ylpurin-8-one is sourced from PubChem (CID 176593793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).