About CID 176593917
CID 176593917 (PubChem CID 176593917) has the molecular formula C32H44N6O7
and a molecular weight of 624.74 g/mol.
Molecular Properties
| Compound Name | CID 176593917 |
| PubChem CID | 176593917 |
| Molecular Formula | C32H44N6O7 |
| Molecular Weight | 624.74 g/mol |
| Exact Mass | 624.33 |
| IUPAC Name | — |
| SMILES | CO[C@H]1CCN(C)[C@@H]1[C@H](C)Oc1nc(-c2onc3c2CCC[C@@]32CCCCC23OCCO3)nc2c1n(C)c(=O)n2[C@@H]1CCOC1 |
| InChI | InChI=1S/C32H44N6O7/c1-19(23-22(40-4)9-14-36(23)2)44-29-24-28(38(30(39)37(24)3)20-10-15-41-18-20)33-27(34-29)25-21-8-7-12-31(26(21)35-45-25)11-5-6-13-32(31)42-16-17-43-32/h19-20,22-23H,5-18H2,1-4H3/t19-,20+,22-,23+,31-/m0/s1 |
| InChIKey | QNHKKDSFLQTUQK-DECUJFKVSA-N |
| XLogP | 3.12 |
| TPSA | 128.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 624.74 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
Analyze CID 176593917 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176593917?
The IUPAC name of CID 176593917 (CID 176593917) is not available.
What is the SMILES notation for CID 176593917?
The canonical SMILES for CID 176593917 is CO[C@H]1CCN(C)[C@@H]1[C@H](C)Oc1nc(-c2onc3c2CCC[C@@]32CCCCC23OCCO3)nc2c1n(C)c(=O)n2[C@@H]1CCOC1.
What is the InChIKey of CID 176593917?
The InChIKey is QNHKKDSFLQTUQK-DECUJFKVSA-N. The full InChI is InChI=1S/C32H44N6O7/c1-19(23-22(40-4)9-14-36(23)2)44-29-24-28(38(30(39)37(24)3)20-10-15-41-18-20)33-27(34-29)25-21-8-7-12-31(26(21)35-45-25)11-5-6-13-32(31)42-16-17-43-32/h19-20,22-23H,5-18H2,1-4H3/t19-,20+,22-,23+,31-/m0/s1.
What are the key properties of CID 176593917?
CID 176593917 has a molecular weight of 624.74 g/mol, XLogP of 3.12, 6 rotatable bonds, 0 hydrogen bond donors, and 13 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176593917 is sourced from PubChem (CID 176593917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).