C23H24F3N3O7S — CID 176594002
[2-[(7S)-2'-oxospiro[5,6-dihydro-4H-1,2-benzoxazole-7,1'-cyclohexane]-3-yl]spiro[5,7-dihydropyrano[4,3-d]pyrimidine-8,3'-oxolane]-4-yl] trifluoromethanesulfonate (PubChem CID 176594002) has the molecular formula C23H24F3N3O7S and a molecular weight of 543.52 g/mol. Its IUPAC name is [2-[(7S)-2'-oxospiro[5,6-dihydro-4H-1,2-benzoxazole-7,1'-cyclohexane]-3-yl]spiro[5,7-dihydropyrano[4,3-d]pyrimidine-8,3'-oxolane]-4-yl] trifluoromethanesulfonate.
| Compound Name | [2-[(7S)-2'-oxospiro[5,6-dihydro-4H-1,2-benzoxazole-7,1'-cyclohexane]-3-yl]spiro[5,7-dihydropyrano[4,3-d]pyrimidine-8,3'-oxolane]-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 176594002 |
| Molecular Formula | C23H24F3N3O7S |
| Molecular Weight | 543.52 g/mol |
| Exact Mass | 543.13 |
| IUPAC Name | [2-[(7S)-2'-oxospiro[5,6-dihydro-4H-1,2-benzoxazole-7,1'-cyclohexane]-3-yl]spiro[5,7-dihydropyrano[4,3-d]pyrimidine-8,3'-oxolane]-4-yl] trifluoromethanesulfonate |
| SMILES | O=C1CCCC[C@@]12CCCc1c(-c3nc(OS(=O)(=O)C(F)(F)F)c4c(n3)C3(CCOC3)COC4)noc12 |
| InChI | InChI=1S/C23H24F3N3O7S/c24-23(25,26)37(31,32)36-20-14-10-34-12-21(8-9-33-11-21)17(14)27-19(28-20)16-13-4-3-7-22(18(13)35-29-16)6-2-1-5-15(22)30/h1-12H2/t21?,22-/m1/s1 |
| InChIKey | MIESXHVCSJRTTP-FOIFJWKZSA-N |
| XLogP | 3.27 |
| TPSA | 130.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.52 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|