C12H11Cl2FN4O2 — CID 176594104
4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepan-6-ol (PubChem CID 176594104) has the molecular formula C12H11Cl2FN4O2 and a molecular weight of 333.15 g/mol. Its IUPAC name is 4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepan-6-ol.
| Compound Name | 4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepan-6-ol |
|---|---|
| PubChem CID | 176594104 |
| Molecular Formula | C12H11Cl2FN4O2 |
| Molecular Weight | 333.15 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepan-6-ol |
| SMILES | OC1COCCN(c2nc(Cl)nc3c(F)c(Cl)ncc23)C1 |
| InChI | InChI=1S/C12H11Cl2FN4O2/c13-10-8(15)9-7(3-16-10)11(18-12(14)17-9)19-1-2-21-5-6(20)4-19/h3,6,20H,1-2,4-5H2 |
| InChIKey | GCRKLPJTZRVABC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 71.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.15 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|