C14H27NO — CID 176594264
4-[[1-(3-methylbutyl)cyclopropyl]methyl]-1,4-oxazepane (PubChem CID 176594264) has the molecular formula C14H27NO and a molecular weight of 225.38 g/mol. Its IUPAC name is 4-[[1-(3-methylbutyl)cyclopropyl]methyl]-1,4-oxazepane.
| Compound Name | 4-[[1-(3-methylbutyl)cyclopropyl]methyl]-1,4-oxazepane |
|---|---|
| PubChem CID | 176594264 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | 4-[[1-(3-methylbutyl)cyclopropyl]methyl]-1,4-oxazepane |
| SMILES | CC(C)CCC1(CN2CCCOCC2)CC1 |
| InChI | InChI=1S/C14H27NO/c1-13(2)4-5-14(6-7-14)12-15-8-3-10-16-11-9-15/h13H,3-12H2,1-2H3 |
| InChIKey | DNXROWVCPHZLGK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |