C52H51N — CID 176595100
1',3',4',5',6',7',8'-heptadeuterio-N-(4-naphthalen-1-ylphenyl)-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-1-yl)spiro[adamantane-2,9'-fluorene]-2'-amine (PubChem CID 176595100) has the molecular formula C52H51N and a molecular weight of 697.03 g/mol. Its IUPAC name is 1',3',4',5',6',7',8'-heptadeuterio-N-(4-naphthalen-1-ylphenyl)-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-1-yl)spiro[adamantane-2,9'-fluorene]-2'-amine.
| Compound Name | 1',3',4',5',6',7',8'-heptadeuterio-N-(4-naphthalen-1-ylphenyl)-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-1-yl)spiro[adamantane-2,9'-fluorene]-2'-amine |
|---|---|
| PubChem CID | 176595100 |
| Molecular Formula | C52H51N |
| Molecular Weight | 697.03 g/mol |
| Exact Mass | 696.45 |
| IUPAC Name | 1',3',4',5',6',7',8'-heptadeuterio-N-(4-naphthalen-1-ylphenyl)-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-1-yl)spiro[adamantane-2,9'-fluorene]-2'-amine |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])-c1c([2H])c([2H])c(N(c3ccc(-c4cccc5ccccc45)cc3)c3cccc4c3C(C)(C)CCC4(C)C)c([2H])c1C21C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C52H51N/c1-50(2)25-26-51(3,4)49-46(50)17-10-18-48(49)53(39-21-19-36(20-22-39)42-15-9-12-35-11-5-6-13-41(35)42)40-23-24-44-43-14-7-8-16-45(43)52(47(44)32-40)37-28-33-27-34(30-37)31-38(52)29-33/h5-24,32-34,37-38H,25-31H2,1-4H3/i7D,8D,14D,16D,23D,24D,32D |
| InChIKey | NDINKJJWMGMHCU-RBATYBGUSA-N |
| XLogP | 14.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.03 |
| LogP ≤ 5 | 14.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |