C17H14 — CID 176595393
1,2,3,4,5,8-hexadeuterio-6-(2,3,5,6-tetradeuterio-4-methylphenyl)naphthalene (PubChem CID 176595393) has the molecular formula C17H14 and a molecular weight of 228.36 g/mol. Its IUPAC name is 1,2,3,4,5,8-hexadeuterio-6-(2,3,5,6-tetradeuterio-4-methylphenyl)naphthalene.
| Compound Name | 1,2,3,4,5,8-hexadeuterio-6-(2,3,5,6-tetradeuterio-4-methylphenyl)naphthalene |
|---|---|
| PubChem CID | 176595393 |
| Molecular Formula | C17H14 |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 1,2,3,4,5,8-hexadeuterio-6-(2,3,5,6-tetradeuterio-4-methylphenyl)naphthalene |
| SMILES | [2H]c1c([2H])c(-c2cc([2H])c3c([2H])c([2H])c([2H])c([2H])c3c2[2H])c([2H])c([2H])c1C |
| InChI | InChI=1S/C17H14/c1-13-6-8-15(9-7-13)17-11-10-14-4-2-3-5-16(14)12-17/h2-12H,1H3/i2D,3D,4D,5D,6D,7D,8D,9D,10D,12D |
| InChIKey | ZXXGUXICWKNYJD-KBFDYQLKSA-N |
| XLogP | 4.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |