C56H63NO — CID 176596097
1'-phenyl-N,N-bis(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-1-yl)spiro[adamantane-2,9'-xanthene]-3'-amine (PubChem CID 176596097) has the molecular formula C56H63NO and a molecular weight of 766.13 g/mol. Its IUPAC name is 1'-phenyl-N,N-bis(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-1-yl)spiro[adamantane-2,9'-xanthene]-3'-amine.
| Compound Name | 1'-phenyl-N,N-bis(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-1-yl)spiro[adamantane-2,9'-xanthene]-3'-amine |
|---|---|
| PubChem CID | 176596097 |
| Molecular Formula | C56H63NO |
| Molecular Weight | 766.13 g/mol |
| Exact Mass | 765.49 |
| IUPAC Name | 1'-phenyl-N,N-bis(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-1-yl)spiro[adamantane-2,9'-xanthene]-3'-amine |
| SMILES | CC1(C)CCC(C)(C)c2c(N(c3cc4c(c(-c5ccccc5)c3)C3(c5ccccc5O4)C4CC5CC(C4)CC3C5)c3cccc4c3C(C)(C)CCC4(C)C)cccc21 |
| InChI | InChI=1S/C56H63NO/c1-52(2)24-26-54(5,6)50-43(52)19-14-21-45(50)57(46-22-15-20-44-51(46)55(7,8)27-25-53(44,3)4)40-33-41(37-16-10-9-11-17-37)49-48(34-40)58-47-23-13-12-18-42(47)56(49)38-29-35-28-36(31-38)32-39(56)30-35/h9-23,33-36,38-39H,24-32H2,1-8H3 |
| InChIKey | PQYHMTBSQZYPPM-UHFFFAOYSA-N |
| XLogP | 15.37 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.13 |
| LogP ≤ 5 | 15.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |