C16H30N4O — CID 176596322
N-[3-[4-[(tert-butylamino)methyl]imidazol-1-yl]propyl]-2,2-dimethylpropanamide (PubChem CID 176596322) has the molecular formula C16H30N4O and a molecular weight of 294.44 g/mol. Its IUPAC name is N-[3-[4-[(tert-butylamino)methyl]imidazol-1-yl]propyl]-2,2-dimethylpropanamide.
| Compound Name | N-[3-[4-[(tert-butylamino)methyl]imidazol-1-yl]propyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 176596322 |
| Molecular Formula | C16H30N4O |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.24 |
| IUPAC Name | N-[3-[4-[(tert-butylamino)methyl]imidazol-1-yl]propyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)NCc1cn(CCCNC(=O)C(C)(C)C)cn1 |
| InChI | InChI=1S/C16H30N4O/c1-15(2,3)14(21)17-8-7-9-20-11-13(18-12-20)10-19-16(4,5)6/h11-12,19H,7-10H2,1-6H3,(H,17,21) |
| InChIKey | CMVCFLBXFBXTKH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|