C20H12Br3F4O7S- — CID 176596769
2,3,5,6-tetrafluoro-4-[4-(2,4,6-tribromobenzoyl)oxycyclohexanecarbonyl]oxybenzenesulfonate (PubChem CID 176596769) has the molecular formula C20H12Br3F4O7S- and a molecular weight of 712.08 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[4-(2,4,6-tribromobenzoyl)oxycyclohexanecarbonyl]oxybenzenesulfonate.
| Compound Name | 2,3,5,6-tetrafluoro-4-[4-(2,4,6-tribromobenzoyl)oxycyclohexanecarbonyl]oxybenzenesulfonate |
|---|---|
| PubChem CID | 176596769 |
| Molecular Formula | C20H12Br3F4O7S- |
| Molecular Weight | 712.08 g/mol |
| Exact Mass | 708.78 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[4-(2,4,6-tribromobenzoyl)oxycyclohexanecarbonyl]oxybenzenesulfonate |
| SMILES | O=C(OC1CCC(C(=O)Oc2c(F)c(F)c(S(=O)(=O)[O-])c(F)c2F)CC1)c1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C20H13Br3F4O7S/c21-8-5-10(22)12(11(23)6-8)20(29)33-9-3-1-7(2-4-9)19(28)34-17-13(24)15(26)18(35(30,31)32)16(27)14(17)25/h5-7,9H,1-4H2,(H,30,31,32)/p-1 |
| InChIKey | XCKKRBBCFVNTJZ-UHFFFAOYSA-M |
| XLogP | 5.76 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.08 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|