C25H21ClF2N4O — CID 176596981
7-(8-chloronaphthalen-1-yl)-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidine (PubChem CID 176596981) has the molecular formula C25H21ClF2N4O and a molecular weight of 466.92 g/mol. Its IUPAC name is 7-(8-chloronaphthalen-1-yl)-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidine.
| Compound Name | 7-(8-chloronaphthalen-1-yl)-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 176596981 |
| Molecular Formula | C25H21ClF2N4O |
| Molecular Weight | 466.92 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 7-(8-chloronaphthalen-1-yl)-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidine |
| SMILES | Fc1c(-c2cccc3cccc(Cl)c23)ncc2cnc(OC[C@@]34CCCN3C[C@H](F)C4)nc12 |
| InChI | InChI=1S/C25H21ClF2N4O/c26-19-7-2-5-15-4-1-6-18(20(15)19)23-21(28)22-16(11-29-23)12-30-24(31-22)33-14-25-8-3-9-32(25)13-17(27)10-25/h1-2,4-7,11-12,17H,3,8-10,13-14H2/t17-,25+/m1/s1 |
| InChIKey | PZULRYPUDXABER-NSYGIPOTSA-N |
| XLogP | 5.59 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.92 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |