C49H31N2OS+ — CID 176597266
3-phenyl-5-(4-phenylphenyl)-1-spiro[indeno[1,2-e][1]benzofuran-6,9'-thioxanthene]-8-ylpyrazin-1-ium (PubChem CID 176597266) has the molecular formula C49H31N2OS+ and a molecular weight of 695.87 g/mol. Its IUPAC name is 3-phenyl-5-(4-phenylphenyl)-1-spiro[indeno[1,2-e][1]benzofuran-6,9'-thioxanthene]-8-ylpyrazin-1-ium.
| Compound Name | 3-phenyl-5-(4-phenylphenyl)-1-spiro[indeno[1,2-e][1]benzofuran-6,9'-thioxanthene]-8-ylpyrazin-1-ium |
|---|---|
| PubChem CID | 176597266 |
| Molecular Formula | C49H31N2OS+ |
| Molecular Weight | 695.87 g/mol |
| Exact Mass | 695.22 |
| IUPAC Name | 3-phenyl-5-(4-phenylphenyl)-1-spiro[indeno[1,2-e][1]benzofuran-6,9'-thioxanthene]-8-ylpyrazin-1-ium |
| SMILES | c1ccc(-c2ccc(-c3c[n+](-c4ccc5c(c4)C4(c6ccccc6Sc6ccccc64)c4ccc6occc6c4-5)cc(-c4ccccc4)n3)cc2)cc1 |
| InChI | InChI=1S/C49H31N2OS/c1-3-11-32(12-4-1)33-19-21-35(22-20-33)44-31-51(30-43(50-44)34-13-5-2-6-14-34)36-23-24-37-42(29-36)49(41-25-26-45-38(48(37)41)27-28-52-45)39-15-7-9-17-46(39)53-47-18-10-8-16-40(47)49/h1-31H/q+1 |
| InChIKey | UCXJPVAIDUDIEM-UHFFFAOYSA-N |
| XLogP | 11.93 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.87 |
| LogP ≤ 5 | 11.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|