C31H29FN4O2S — CID 176598881
N-[(R)-(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-5-[4-(1-methylpiperidin-4-yl)phenyl]-1,3-thiazole-2-carboxamide (PubChem CID 176598881) has the molecular formula C31H29FN4O2S and a molecular weight of 540.66 g/mol. Its IUPAC name is N-[(R)-(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-5-[4-(1-methylpiperidin-4-yl)phenyl]-1,3-thiazole-2-carboxamide.
| Compound Name | N-[(R)-(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-5-[4-(1-methylpiperidin-4-yl)phenyl]-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 176598881 |
| Molecular Formula | C31H29FN4O2S |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | N-[(R)-(5-fluoro-2-hydroxyphenyl)-(1H-indol-2-yl)methyl]-5-[4-(1-methylpiperidin-4-yl)phenyl]-1,3-thiazole-2-carboxamide |
| SMILES | CN1CCC(c2ccc(-c3cnc(C(=O)N[C@@H](c4cc5ccccc5[nH]4)c4cc(F)ccc4O)s3)cc2)CC1 |
| InChI | InChI=1S/C31H29FN4O2S/c1-36-14-12-20(13-15-36)19-6-8-21(9-7-19)28-18-33-31(39-28)30(38)35-29(24-17-23(32)10-11-27(24)37)26-16-22-4-2-3-5-25(22)34-26/h2-11,16-18,20,29,34,37H,12-15H2,1H3,(H,35,38)/t29-/m1/s1 |
| InChIKey | VHVCHYTVTVBMHA-GDLZYMKVSA-N |
| XLogP | 6.46 |
| TPSA | 81.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|