C13H21N — CID 176598945
(1R,5S)-8-(3-methylbut-1-ynyl)-3-(trideuteriomethyl)-3-azabicyclo[3.2.1]octane (PubChem CID 176598945) has the molecular formula C13H21N and a molecular weight of 194.34 g/mol. Its IUPAC name is (1R,5S)-8-(3-methylbut-1-ynyl)-3-(trideuteriomethyl)-3-azabicyclo[3.2.1]octane.
| Compound Name | (1R,5S)-8-(3-methylbut-1-ynyl)-3-(trideuteriomethyl)-3-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 176598945 |
| Molecular Formula | C13H21N |
| Molecular Weight | 194.34 g/mol |
| Exact Mass | 194.19 |
| IUPAC Name | (1R,5S)-8-(3-methylbut-1-ynyl)-3-(trideuteriomethyl)-3-azabicyclo[3.2.1]octane |
| SMILES | [2H]C([2H])([2H])N1C[C@H]2CC[C@@H](C1)C2C#CC(C)C |
| InChI | InChI=1S/C13H21N/c1-10(2)4-7-13-11-5-6-12(13)9-14(3)8-11/h10-13H,5-6,8-9H2,1-3H3/t11-,12+,13?/i3D3 |
| InChIKey | KVZNVCDHRWGTKJ-BTYADZPVSA-N |
| XLogP | 2.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|