C24H17FN4O2S — CID 176599335
N-[(5-fluoro-2-hydroxyphenyl)-(4-methyl-1,3-thiazol-2-yl)methyl]-4-(2-pyridin-3-ylethynyl)pyridine-2-carboxamide (PubChem CID 176599335) has the molecular formula C24H17FN4O2S and a molecular weight of 444.49 g/mol. Its IUPAC name is N-[(5-fluoro-2-hydroxyphenyl)-(4-methyl-1,3-thiazol-2-yl)methyl]-4-(2-pyridin-3-ylethynyl)pyridine-2-carboxamide.
| Compound Name | N-[(5-fluoro-2-hydroxyphenyl)-(4-methyl-1,3-thiazol-2-yl)methyl]-4-(2-pyridin-3-ylethynyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 176599335 |
| Molecular Formula | C24H17FN4O2S |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | N-[(5-fluoro-2-hydroxyphenyl)-(4-methyl-1,3-thiazol-2-yl)methyl]-4-(2-pyridin-3-ylethynyl)pyridine-2-carboxamide |
| SMILES | Cc1csc(C(NC(=O)c2cc(C#Cc3cccnc3)ccn2)c2cc(F)ccc2O)n1 |
| InChI | InChI=1S/C24H17FN4O2S/c1-15-14-32-24(28-15)22(19-12-18(25)6-7-21(19)30)29-23(31)20-11-16(8-10-27-20)4-5-17-3-2-9-26-13-17/h2-3,6-14,22,30H,1H3,(H,29,31) |
| InChIKey | RWSJOBSEKHETTD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|