About 2-[[6-chloro-3-(3,6-dihydro-2H-pyran-4-yl)quinolin-4-yl]amino]-5-(hydroxymethyl)benzoic acid
2-[[6-chloro-3-(3,6-dihydro-2H-pyran-4-yl)quinolin-4-yl]amino]-5-(hydroxymethyl)benzoic acid (PubChem CID 176600719) has the molecular formula C22H19ClN2O4
and a molecular weight of 410.86 g/mol. Its IUPAC name is 2-[[6-chloro-3-(3,6-dihydro-2H-pyran-4-yl)quinolin-4-yl]amino]-5-(hydroxymethyl)benzoic acid.
Molecular Properties
| Compound Name | 2-[[6-chloro-3-(3,6-dihydro-2H-pyran-4-yl)quinolin-4-yl]amino]-5-(hydroxymethyl)benzoic acid |
| PubChem CID | 176600719 |
| Molecular Formula | C22H19ClN2O4 |
| Molecular Weight | 410.86 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 2-[[6-chloro-3-(3,6-dihydro-2H-pyran-4-yl)quinolin-4-yl]amino]-5-(hydroxymethyl)benzoic acid |
| SMILES | O=C(O)c1cc(CO)ccc1Nc1c(C2=CCOCC2)cnc2ccc(Cl)cc12 |
| InChI | InChI=1S/C22H19ClN2O4/c23-15-2-4-19-16(10-15)21(18(11-24-19)14-5-7-29-8-6-14)25-20-3-1-13(12-26)9-17(20)22(27)28/h1-5,9-11,26H,6-8,12H2,(H,24,25)(H,27,28) |
| InChIKey | DZSPWAFVPYDRGX-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.86 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[6-chloro-3-(3,6-dihydro-2H-pyran-4-yl)quinolin-4-yl]amino]-5-(hydroxymethyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[6-chloro-3-(3,6-dihydro-2H-pyran-4-yl)quinolin-4-yl]amino]-5-(hydroxymethyl)benzoic acid?
The IUPAC name of 2-[[6-chloro-3-(3,6-dihydro-2H-pyran-4-yl)quinolin-4-yl]amino]-5-(hydroxymethyl)benzoic acid (CID 176600719) is 2-[[6-chloro-3-(3,6-dihydro-2H-pyran-4-yl)quinolin-4-yl]amino]-5-(hydroxymethyl)benzoic acid.
What is the SMILES notation for 2-[[6-chloro-3-(3,6-dihydro-2H-pyran-4-yl)quinolin-4-yl]amino]-5-(hydroxymethyl)benzoic acid?
The canonical SMILES for 2-[[6-chloro-3-(3,6-dihydro-2H-pyran-4-yl)quinolin-4-yl]amino]-5-(hydroxymethyl)benzoic acid is O=C(O)c1cc(CO)ccc1Nc1c(C2=CCOCC2)cnc2ccc(Cl)cc12.
What is the InChIKey of 2-[[6-chloro-3-(3,6-dihydro-2H-pyran-4-yl)quinolin-4-yl]amino]-5-(hydroxymethyl)benzoic acid?
The InChIKey is DZSPWAFVPYDRGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19ClN2O4/c23-15-2-4-19-16(10-15)21(18(11-24-19)14-5-7-29-8-6-14)25-20-3-1-13(12-26)9-17(20)22(27)28/h1-5,9-11,26H,6-8,12H2,(H,24,25)(H,27,28).
What are the key properties of 2-[[6-chloro-3-(3,6-dihydro-2H-pyran-4-yl)quinolin-4-yl]amino]-5-(hydroxymethyl)benzoic acid?
2-[[6-chloro-3-(3,6-dihydro-2H-pyran-4-yl)quinolin-4-yl]amino]-5-(hydroxymethyl)benzoic acid has a molecular weight of 410.86 g/mol, XLogP of 4.63, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[6-chloro-3-(3,6-dihydro-2H-pyran-4-yl)quinolin-4-yl]amino]-5-(hydroxymethyl)benzoic acid is sourced from PubChem (CID 176600719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).