C12H25F3N2O — CID 176601052
N-(2-methylpropyl)-N'-propan-2-yl-N'-[2-(trifluoromethoxy)ethyl]ethane-1,2-diamine (PubChem CID 176601052) has the molecular formula C12H25F3N2O and a molecular weight of 270.34 g/mol. Its IUPAC name is N-(2-methylpropyl)-N'-propan-2-yl-N'-[2-(trifluoromethoxy)ethyl]ethane-1,2-diamine.
| Compound Name | N-(2-methylpropyl)-N'-propan-2-yl-N'-[2-(trifluoromethoxy)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 176601052 |
| Molecular Formula | C12H25F3N2O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | N-(2-methylpropyl)-N'-propan-2-yl-N'-[2-(trifluoromethoxy)ethyl]ethane-1,2-diamine |
| SMILES | CC(C)CNCCN(CCOC(F)(F)F)C(C)C |
| InChI | InChI=1S/C12H25F3N2O/c1-10(2)9-16-5-6-17(11(3)4)7-8-18-12(13,14)15/h10-11,16H,5-9H2,1-4H3 |
| InChIKey | TZBUJRHDUUVMEM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|