C17H36N3O2+ — CID 176601097
trimethyl-[2-[propan-2-yl-[(5-propan-2-yloxycarbonylpyrrolidin-2-yl)methyl]amino]ethyl]azanium (PubChem CID 176601097) has the molecular formula C17H36N3O2+ and a molecular weight of 314.49 g/mol. Its IUPAC name is trimethyl-[2-[propan-2-yl-[(5-propan-2-yloxycarbonylpyrrolidin-2-yl)methyl]amino]ethyl]azanium.
| Compound Name | trimethyl-[2-[propan-2-yl-[(5-propan-2-yloxycarbonylpyrrolidin-2-yl)methyl]amino]ethyl]azanium |
|---|---|
| PubChem CID | 176601097 |
| Molecular Formula | C17H36N3O2+ |
| Molecular Weight | 314.49 g/mol |
| Exact Mass | 314.28 |
| IUPAC Name | trimethyl-[2-[propan-2-yl-[(5-propan-2-yloxycarbonylpyrrolidin-2-yl)methyl]amino]ethyl]azanium |
| SMILES | CC(C)OC(=O)C1CCC(CN(CC[N+](C)(C)C)C(C)C)N1 |
| InChI | InChI=1S/C17H36N3O2/c1-13(2)19(10-11-20(5,6)7)12-15-8-9-16(18-15)17(21)22-14(3)4/h13-16,18H,8-12H2,1-7H3/q+1 |
| InChIKey | ZOLQWEYTMXSDIN-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.49 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|