C34H43F2O6S2- — CID 176602997
1,3-difluoro-4-(2,4,6-tricyclohexylphenyl)sulfonyloxy-5,6,7,8-tetrahydronaphthalene-2-sulfonate (PubChem CID 176602997) has the molecular formula C34H43F2O6S2- and a molecular weight of 649.84 g/mol. Its IUPAC name is 1,3-difluoro-4-(2,4,6-tricyclohexylphenyl)sulfonyloxy-5,6,7,8-tetrahydronaphthalene-2-sulfonate.
| Compound Name | 1,3-difluoro-4-(2,4,6-tricyclohexylphenyl)sulfonyloxy-5,6,7,8-tetrahydronaphthalene-2-sulfonate |
|---|---|
| PubChem CID | 176602997 |
| Molecular Formula | C34H43F2O6S2- |
| Molecular Weight | 649.84 g/mol |
| Exact Mass | 649.25 |
| IUPAC Name | 1,3-difluoro-4-(2,4,6-tricyclohexylphenyl)sulfonyloxy-5,6,7,8-tetrahydronaphthalene-2-sulfonate |
| SMILES | O=S(=O)([O-])c1c(F)c2c(c(OS(=O)(=O)c3c(C4CCCCC4)cc(C4CCCCC4)cc3C3CCCCC3)c1F)CCCC2 |
| InChI | InChI=1S/C34H44F2O6S2/c35-30-26-18-10-11-19-27(26)32(31(36)34(30)43(37,38)39)42-44(40,41)33-28(23-14-6-2-7-15-23)20-25(22-12-4-1-5-13-22)21-29(33)24-16-8-3-9-17-24/h20-24H,1-19H2,(H,37,38,39)/p-1 |
| InChIKey | NDEIYFDDXSJRER-UHFFFAOYSA-M |
| XLogP | 8.66 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.84 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|