C34H44F2O6S2 — CID 176602998
1,3-difluoro-4-(2,4,6-tricyclohexylphenyl)sulfonyloxy-5,6,7,8-tetrahydronaphthalene-2-sulfonic acid (PubChem CID 176602998) has the molecular formula C34H44F2O6S2 and a molecular weight of 650.85 g/mol. Its IUPAC name is 1,3-difluoro-4-(2,4,6-tricyclohexylphenyl)sulfonyloxy-5,6,7,8-tetrahydronaphthalene-2-sulfonic acid.
| Compound Name | 1,3-difluoro-4-(2,4,6-tricyclohexylphenyl)sulfonyloxy-5,6,7,8-tetrahydronaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 176602998 |
| Molecular Formula | C34H44F2O6S2 |
| Molecular Weight | 650.85 g/mol |
| Exact Mass | 650.25 |
| IUPAC Name | 1,3-difluoro-4-(2,4,6-tricyclohexylphenyl)sulfonyloxy-5,6,7,8-tetrahydronaphthalene-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1c(F)c2c(c(OS(=O)(=O)c3c(C4CCCCC4)cc(C4CCCCC4)cc3C3CCCCC3)c1F)CCCC2 |
| InChI | InChI=1S/C34H44F2O6S2/c35-30-26-18-10-11-19-27(26)32(31(36)34(30)43(37,38)39)42-44(40,41)33-28(23-14-6-2-7-15-23)20-25(22-12-4-1-5-13-22)21-29(33)24-16-8-3-9-17-24/h20-24H,1-19H2,(H,37,38,39) |
| InChIKey | NDEIYFDDXSJRER-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.85 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|