C42H48F4O6S2 — CID 176603040
2,3,5,6-tetrafluoro-4-[2,4,6-tris(8-tricyclo[5.2.1.02,6]decanyl)phenyl]sulfonyloxybenzenesulfonic acid (PubChem CID 176603040) has the molecular formula C42H48F4O6S2 and a molecular weight of 788.97 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[2,4,6-tris(8-tricyclo[5.2.1.02,6]decanyl)phenyl]sulfonyloxybenzenesulfonic acid.
| Compound Name | 2,3,5,6-tetrafluoro-4-[2,4,6-tris(8-tricyclo[5.2.1.02,6]decanyl)phenyl]sulfonyloxybenzenesulfonic acid |
|---|---|
| PubChem CID | 176603040 |
| Molecular Formula | C42H48F4O6S2 |
| Molecular Weight | 788.97 g/mol |
| Exact Mass | 788.28 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[2,4,6-tris(8-tricyclo[5.2.1.02,6]decanyl)phenyl]sulfonyloxybenzenesulfonic acid |
| SMILES | O=S(=O)(O)c1c(F)c(F)c(OS(=O)(=O)c2c(C3CC4CC3C3CCCC43)cc(C3CC4CC3C3CCCC43)cc2C2CC3CC2C2CCCC32)c(F)c1F |
| InChI | InChI=1S/C42H48F4O6S2/c43-36-38(45)42(53(47,48)49)39(46)37(44)40(36)52-54(50,51)41-34(32-14-19-12-30(32)26-8-2-5-23(19)26)16-21(28-10-18-11-29(28)25-7-1-4-22(18)25)17-35(41)33-15-20-13-31(33)27-9-3-6-24(20)27/h16-20,22-33H,1-15H2,(H,47,48,49) |
| InChIKey | YKOHMMQJFDGNDK-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.97 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|