C11H20O3S — CID 176603078
3-[3-[(E)-prop-1-enoxy]propyl]thiane 1,1-dioxide (PubChem CID 176603078) has the molecular formula C11H20O3S and a molecular weight of 232.34 g/mol. Its IUPAC name is 3-[3-[(E)-prop-1-enoxy]propyl]thiane 1,1-dioxide.
| Compound Name | 3-[3-[(E)-prop-1-enoxy]propyl]thiane 1,1-dioxide |
|---|---|
| PubChem CID | 176603078 |
| Molecular Formula | C11H20O3S |
| Molecular Weight | 232.34 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 3-[3-[(E)-prop-1-enoxy]propyl]thiane 1,1-dioxide |
| SMILES | C/C=C/OCCCC1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H20O3S/c1-2-7-14-8-3-5-11-6-4-9-15(12,13)10-11/h2,7,11H,3-6,8-10H2,1H3/b7-2+ |
| InChIKey | NOGXJNVCSSRMIB-FARCUNLSSA-N |
| XLogP | 2.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|