C35H45F3O6S2 — CID 176603103
4-(2,4,6-tricyclohexylphenyl)sulfonyloxy-2-(trifluoromethyl)-5,6,7,8-tetrahydronaphthalene-1-sulfonic acid (PubChem CID 176603103) has the molecular formula C35H45F3O6S2 and a molecular weight of 682.87 g/mol. Its IUPAC name is 4-(2,4,6-tricyclohexylphenyl)sulfonyloxy-2-(trifluoromethyl)-5,6,7,8-tetrahydronaphthalene-1-sulfonic acid.
| Compound Name | 4-(2,4,6-tricyclohexylphenyl)sulfonyloxy-2-(trifluoromethyl)-5,6,7,8-tetrahydronaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 176603103 |
| Molecular Formula | C35H45F3O6S2 |
| Molecular Weight | 682.87 g/mol |
| Exact Mass | 682.26 |
| IUPAC Name | 4-(2,4,6-tricyclohexylphenyl)sulfonyloxy-2-(trifluoromethyl)-5,6,7,8-tetrahydronaphthalene-1-sulfonic acid |
| SMILES | O=S(=O)(O)c1c(C(F)(F)F)cc(OS(=O)(=O)c2c(C3CCCCC3)cc(C3CCCCC3)cc2C2CCCCC2)c2c1CCCC2 |
| InChI | InChI=1S/C35H45F3O6S2/c36-35(37,38)31-22-32(27-18-10-11-19-28(27)34(31)45(39,40)41)44-46(42,43)33-29(24-14-6-2-7-15-24)20-26(23-12-4-1-5-13-23)21-30(33)25-16-8-3-9-17-25/h20-25H,1-19H2,(H,39,40,41) |
| InChIKey | QJQJHSFAANCARH-UHFFFAOYSA-N |
| XLogP | 9.74 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.87 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|