C32H37F6O6S4- — CID 176603137
4-(2,4,6-tricyclohexylphenyl)sulfonyloxy-2,3-bis(trifluoromethylsulfanyl)benzenesulfonate (PubChem CID 176603137) has the molecular formula C32H37F6O6S4- and a molecular weight of 759.90 g/mol. Its IUPAC name is 4-(2,4,6-tricyclohexylphenyl)sulfonyloxy-2,3-bis(trifluoromethylsulfanyl)benzenesulfonate.
| Compound Name | 4-(2,4,6-tricyclohexylphenyl)sulfonyloxy-2,3-bis(trifluoromethylsulfanyl)benzenesulfonate |
|---|---|
| PubChem CID | 176603137 |
| Molecular Formula | C32H37F6O6S4- |
| Molecular Weight | 759.90 g/mol |
| Exact Mass | 759.14 |
| IUPAC Name | 4-(2,4,6-tricyclohexylphenyl)sulfonyloxy-2,3-bis(trifluoromethylsulfanyl)benzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccc(OS(=O)(=O)c2c(C3CCCCC3)cc(C3CCCCC3)cc2C2CCCCC2)c(SC(F)(F)F)c1SC(F)(F)F |
| InChI | InChI=1S/C32H38F6O6S4/c33-31(34,35)45-28-26(16-17-27(47(39,40)41)29(28)46-32(36,37)38)44-48(42,43)30-24(21-12-6-2-7-13-21)18-23(20-10-4-1-5-11-20)19-25(30)22-14-8-3-9-15-22/h16-22H,1-15H2,(H,39,40,41)/p-1 |
| InChIKey | HLCADDCOJQFDHU-UHFFFAOYSA-M |
| XLogP | 10.73 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.90 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|