C30H39FO6S2 — CID 176603170
2-fluoro-4-(2,4,6-tricyclohexylphenyl)sulfonyloxybenzenesulfonic acid (PubChem CID 176603170) has the molecular formula C30H39FO6S2 and a molecular weight of 578.77 g/mol. Its IUPAC name is 2-fluoro-4-(2,4,6-tricyclohexylphenyl)sulfonyloxybenzenesulfonic acid.
| Compound Name | 2-fluoro-4-(2,4,6-tricyclohexylphenyl)sulfonyloxybenzenesulfonic acid |
|---|---|
| PubChem CID | 176603170 |
| Molecular Formula | C30H39FO6S2 |
| Molecular Weight | 578.77 g/mol |
| Exact Mass | 578.22 |
| IUPAC Name | 2-fluoro-4-(2,4,6-tricyclohexylphenyl)sulfonyloxybenzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(OS(=O)(=O)c2c(C3CCCCC3)cc(C3CCCCC3)cc2C2CCCCC2)cc1F |
| InChI | InChI=1S/C30H39FO6S2/c31-28-20-25(16-17-29(28)38(32,33)34)37-39(35,36)30-26(22-12-6-2-7-13-22)18-24(21-10-4-1-5-11-21)19-27(30)23-14-8-3-9-15-23/h16-23H,1-15H2,(H,32,33,34) |
| InChIKey | JNGLDZBKWUYWPG-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.77 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|