C33H35F4O6S2- — CID 176603198
2,3,5,6-tetrafluoro-4-[2,4,6-tris(2-bicyclo[2.2.1]heptanyl)phenyl]sulfonyloxybenzenesulfonate (PubChem CID 176603198) has the molecular formula C33H35F4O6S2- and a molecular weight of 667.76 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[2,4,6-tris(2-bicyclo[2.2.1]heptanyl)phenyl]sulfonyloxybenzenesulfonate.
| Compound Name | 2,3,5,6-tetrafluoro-4-[2,4,6-tris(2-bicyclo[2.2.1]heptanyl)phenyl]sulfonyloxybenzenesulfonate |
|---|---|
| PubChem CID | 176603198 |
| Molecular Formula | C33H35F4O6S2- |
| Molecular Weight | 667.76 g/mol |
| Exact Mass | 667.18 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[2,4,6-tris(2-bicyclo[2.2.1]heptanyl)phenyl]sulfonyloxybenzenesulfonate |
| SMILES | O=S(=O)([O-])c1c(F)c(F)c(OS(=O)(=O)c2c(C3CC4CCC3C4)cc(C3CC4CCC3C4)cc2C2CC3CCC2C3)c(F)c1F |
| InChI | InChI=1S/C33H36F4O6S2/c34-27-29(36)33(44(38,39)40)30(37)28(35)31(27)43-45(41,42)32-25(23-11-16-2-5-19(23)8-16)13-21(22-10-15-1-4-18(22)7-15)14-26(32)24-12-17-3-6-20(24)9-17/h13-20,22-24H,1-12H2,(H,38,39,40)/p-1 |
| InChIKey | LSJNIFUPXHBYAL-UHFFFAOYSA-M |
| XLogP | 7.63 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.76 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|