C10H16O3S — CID 176603256
2-[1-(cyclopentylidenemethoxy)ethyl]thiirane 1,1-dioxide (PubChem CID 176603256) has the molecular formula C10H16O3S and a molecular weight of 216.30 g/mol. Its IUPAC name is 2-[1-(cyclopentylidenemethoxy)ethyl]thiirane 1,1-dioxide.
| Compound Name | 2-[1-(cyclopentylidenemethoxy)ethyl]thiirane 1,1-dioxide |
|---|---|
| PubChem CID | 176603256 |
| Molecular Formula | C10H16O3S |
| Molecular Weight | 216.30 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 2-[1-(cyclopentylidenemethoxy)ethyl]thiirane 1,1-dioxide |
| SMILES | CC(OC=C1CCCC1)C1CS1(=O)=O |
| InChI | InChI=1S/C10H16O3S/c1-8(10-7-14(10,11)12)13-6-9-4-2-3-5-9/h6,8,10H,2-5,7H2,1H3 |
| InChIKey | LEKJJNGBHSKWDD-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|