C14H24OS2 — CID 176603296
2-[3-(cyclohexylidenemethoxy)propyl]-1,4-dithiane (PubChem CID 176603296) has the molecular formula C14H24OS2 and a molecular weight of 272.48 g/mol. Its IUPAC name is 2-[3-(cyclohexylidenemethoxy)propyl]-1,4-dithiane.
| Compound Name | 2-[3-(cyclohexylidenemethoxy)propyl]-1,4-dithiane |
|---|---|
| PubChem CID | 176603296 |
| Molecular Formula | C14H24OS2 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 2-[3-(cyclohexylidenemethoxy)propyl]-1,4-dithiane |
| SMILES | C(OCCCC1CSCCS1)=C1CCCCC1 |
| InChI | InChI=1S/C14H24OS2/c1-2-5-13(6-3-1)11-15-8-4-7-14-12-16-9-10-17-14/h11,14H,1-10,12H2 |
| InChIKey | GIYZXABPDXSOKB-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|