C42H41F4O9S2- — CID 176603326
2,3,5,6-tetrafluoro-4-[2,4,6-tris(4-oxo-2-adamantyl)phenyl]sulfonyloxybenzenesulfonate (PubChem CID 176603326) has the molecular formula C42H41F4O9S2- and a molecular weight of 829.91 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[2,4,6-tris(4-oxo-2-adamantyl)phenyl]sulfonyloxybenzenesulfonate.
| Compound Name | 2,3,5,6-tetrafluoro-4-[2,4,6-tris(4-oxo-2-adamantyl)phenyl]sulfonyloxybenzenesulfonate |
|---|---|
| PubChem CID | 176603326 |
| Molecular Formula | C42H41F4O9S2- |
| Molecular Weight | 829.91 g/mol |
| Exact Mass | 829.21 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[2,4,6-tris(4-oxo-2-adamantyl)phenyl]sulfonyloxybenzenesulfonate |
| SMILES | O=C1C2CC3CC(C2)C(c2cc(C4C5CC6CC(C5)C(=O)C4C6)c(S(=O)(=O)Oc4c(F)c(F)c(S(=O)(=O)[O-])c(F)c4F)c(C4C5CC6CC(C5)C(=O)C4C6)c2)C1C3 |
| InChI | InChI=1S/C42H42F4O9S2/c43-33-35(45)42(56(50,51)52)36(46)34(44)40(33)55-57(53,54)41-28(31-19-2-16-5-23(11-19)38(48)26(31)8-16)13-21(30-18-1-15-4-22(10-18)37(47)25(30)7-15)14-29(41)32-20-3-17-6-24(12-20)39(49)27(32)9-17/h13-20,22-27,30-32H,1-12H2,(H,50,51,52)/p-1 |
| InChIKey | BHQIBRKYKNLFNI-UHFFFAOYSA-M |
| XLogP | 7.07 |
| TPSA | 151.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.91 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|