About 2-(2-methylprop-1-enoxymethyl)-1,4-dithiane
2-(2-methylprop-1-enoxymethyl)-1,4-dithiane (PubChem CID 176603370) has the molecular formula C9H16OS2
and a molecular weight of 204.36 g/mol. Its IUPAC name is 2-(2-methylprop-1-enoxymethyl)-1,4-dithiane.
Molecular Properties
| Compound Name | 2-(2-methylprop-1-enoxymethyl)-1,4-dithiane |
| PubChem CID | 176603370 |
| Molecular Formula | C9H16OS2 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 2-(2-methylprop-1-enoxymethyl)-1,4-dithiane |
| SMILES | CC(C)=COCC1CSCCS1 |
| InChI | InChI=1S/C9H16OS2/c1-8(2)5-10-6-9-7-11-3-4-12-9/h5,9H,3-4,6-7H2,1-2H3 |
| InChIKey | CPSOWCSHTNYNIX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methylprop-1-enoxymethyl)-1,4-dithiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylprop-1-enoxymethyl)-1,4-dithiane?
The IUPAC name of 2-(2-methylprop-1-enoxymethyl)-1,4-dithiane (CID 176603370) is 2-(2-methylprop-1-enoxymethyl)-1,4-dithiane.
What is the SMILES notation for 2-(2-methylprop-1-enoxymethyl)-1,4-dithiane?
The canonical SMILES for 2-(2-methylprop-1-enoxymethyl)-1,4-dithiane is CC(C)=COCC1CSCCS1.
What is the InChIKey of 2-(2-methylprop-1-enoxymethyl)-1,4-dithiane?
The InChIKey is CPSOWCSHTNYNIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16OS2/c1-8(2)5-10-6-9-7-11-3-4-12-9/h5,9H,3-4,6-7H2,1-2H3.
What are the key properties of 2-(2-methylprop-1-enoxymethyl)-1,4-dithiane?
2-(2-methylprop-1-enoxymethyl)-1,4-dithiane has a molecular weight of 204.36 g/mol, XLogP of 2.78, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylprop-1-enoxymethyl)-1,4-dithiane is sourced from PubChem (CID 176603370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).