C13H22OS2 — CID 176603376
2-(cyclopentylidenemethoxymethyl)-2-ethyl-1,4-dithiane (PubChem CID 176603376) has the molecular formula C13H22OS2 and a molecular weight of 258.45 g/mol. Its IUPAC name is 2-(cyclopentylidenemethoxymethyl)-2-ethyl-1,4-dithiane.
| Compound Name | 2-(cyclopentylidenemethoxymethyl)-2-ethyl-1,4-dithiane |
|---|---|
| PubChem CID | 176603376 |
| Molecular Formula | C13H22OS2 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 2-(cyclopentylidenemethoxymethyl)-2-ethyl-1,4-dithiane |
| SMILES | CCC1(COC=C2CCCC2)CSCCS1 |
| InChI | InChI=1S/C13H22OS2/c1-2-13(11-15-7-8-16-13)10-14-9-12-5-3-4-6-12/h9H,2-8,10-11H2,1H3 |
| InChIKey | KKXNOBAKJKUXSJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|