C15H26O3S — CID 176603550
3-(cyclohexylidenemethoxymethyl)-3-ethylthiane 1,1-dioxide (PubChem CID 176603550) has the molecular formula C15H26O3S and a molecular weight of 286.44 g/mol. Its IUPAC name is 3-(cyclohexylidenemethoxymethyl)-3-ethylthiane 1,1-dioxide.
| Compound Name | 3-(cyclohexylidenemethoxymethyl)-3-ethylthiane 1,1-dioxide |
|---|---|
| PubChem CID | 176603550 |
| Molecular Formula | C15H26O3S |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | 3-(cyclohexylidenemethoxymethyl)-3-ethylthiane 1,1-dioxide |
| SMILES | CCC1(COC=C2CCCCC2)CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H26O3S/c1-2-15(9-6-10-19(16,17)13-15)12-18-11-14-7-4-3-5-8-14/h11H,2-10,12-13H2,1H3 |
| InChIKey | HBXZTYCREMCANB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|