About 3-ethyl-3-[[(E)-prop-1-enoxy]methyl]thietane 1-oxide
3-ethyl-3-[[(E)-prop-1-enoxy]methyl]thietane 1-oxide (PubChem CID 176603714) has the molecular formula C9H16O2S
and a molecular weight of 188.29 g/mol. Its IUPAC name is 3-ethyl-3-[[(E)-prop-1-enoxy]methyl]thietane 1-oxide.
Molecular Properties
| Compound Name | 3-ethyl-3-[[(E)-prop-1-enoxy]methyl]thietane 1-oxide |
| PubChem CID | 176603714 |
| Molecular Formula | C9H16O2S |
| Molecular Weight | 188.29 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 3-ethyl-3-[[(E)-prop-1-enoxy]methyl]thietane 1-oxide |
| SMILES | C/C=C/OCC1(CC)CS(=O)C1 |
| InChI | InChI=1S/C9H16O2S/c1-3-5-11-6-9(4-2)7-12(10)8-9/h3,5H,4,6-8H2,1-2H3/b5-3+ |
| InChIKey | MHBGXVWIHKKFHX-HWKANZROSA-N |
| XLogP | 1.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-3-[[(E)-prop-1-enoxy]methyl]thietane 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-3-[[(E)-prop-1-enoxy]methyl]thietane 1-oxide?
The IUPAC name of 3-ethyl-3-[[(E)-prop-1-enoxy]methyl]thietane 1-oxide (CID 176603714) is 3-ethyl-3-[[(E)-prop-1-enoxy]methyl]thietane 1-oxide.
What is the SMILES notation for 3-ethyl-3-[[(E)-prop-1-enoxy]methyl]thietane 1-oxide?
The canonical SMILES for 3-ethyl-3-[[(E)-prop-1-enoxy]methyl]thietane 1-oxide is C/C=C/OCC1(CC)CS(=O)C1.
What is the InChIKey of 3-ethyl-3-[[(E)-prop-1-enoxy]methyl]thietane 1-oxide?
The InChIKey is MHBGXVWIHKKFHX-HWKANZROSA-N. The full InChI is InChI=1S/C9H16O2S/c1-3-5-11-6-9(4-2)7-12(10)8-9/h3,5H,4,6-8H2,1-2H3/b5-3+.
What are the key properties of 3-ethyl-3-[[(E)-prop-1-enoxy]methyl]thietane 1-oxide?
3-ethyl-3-[[(E)-prop-1-enoxy]methyl]thietane 1-oxide has a molecular weight of 188.29 g/mol, XLogP of 1.70, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-3-[[(E)-prop-1-enoxy]methyl]thietane 1-oxide is sourced from PubChem (CID 176603714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).