C43H42F4O8S — CID 176603773
2,3,5,6-tetrafluoro-4-[2,4,6-tris(4-oxo-2-adamantyl)benzoyl]oxybenzenesulfonic acid (PubChem CID 176603773) has the molecular formula C43H42F4O8S and a molecular weight of 794.86 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[2,4,6-tris(4-oxo-2-adamantyl)benzoyl]oxybenzenesulfonic acid.
| Compound Name | 2,3,5,6-tetrafluoro-4-[2,4,6-tris(4-oxo-2-adamantyl)benzoyl]oxybenzenesulfonic acid |
|---|---|
| PubChem CID | 176603773 |
| Molecular Formula | C43H42F4O8S |
| Molecular Weight | 794.86 g/mol |
| Exact Mass | 794.25 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[2,4,6-tris(4-oxo-2-adamantyl)benzoyl]oxybenzenesulfonic acid |
| SMILES | O=C(Oc1c(F)c(F)c(S(=O)(=O)O)c(F)c1F)c1c(C2C3CC4CC(C3)C(=O)C2C4)cc(C2C3CC4CC(C3)C(=O)C2C4)cc1C1C2CC3CC(C2)C(=O)C1C3 |
| InChI | InChI=1S/C43H42F4O8S/c44-34-36(46)42(56(52,53)54)37(47)35(45)41(34)55-43(51)33-25(31-19-2-16-5-23(11-19)39(49)28(31)8-16)13-21(30-18-1-15-4-22(10-18)38(48)27(30)7-15)14-26(33)32-20-3-17-6-24(12-20)40(50)29(32)9-17/h13-20,22-24,27-32H,1-12H2,(H,52,53,54) |
| InChIKey | YNMJNGXZUJNOJP-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 131.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.86 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|